C20H25ClN4O5 — CID 55400582
[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 55400582) has the molecular formula C20H25ClN4O5 and a molecular weight of 436.90 g/mol. Its IUPAC name is [2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 55400582 |
| Molecular Formula | C20H25ClN4O5 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | [2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCC1(C)NC(=O)N(CC(=O)OCC(=O)N2CCN(c3cccc(Cl)c3)CC2)C1=O |
| InChI | InChI=1S/C20H25ClN4O5/c1-3-20(2)18(28)25(19(29)22-20)12-17(27)30-13-16(26)24-9-7-23(8-10-24)15-6-4-5-14(21)11-15/h4-6,11H,3,7-10,12-13H2,1-2H3,(H,22,29) |
| InChIKey | GTDWDQHZJMCDBI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|