C20H23ClN4O4 — CID 75392176
3-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4,8-trione (PubChem CID 75392176) has the molecular formula C20H23ClN4O4 and a molecular weight of 418.88 g/mol. Its IUPAC name is 3-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4,8-trione.
| Compound Name | 3-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4,8-trione |
|---|---|
| PubChem CID | 75392176 |
| Molecular Formula | C20H23ClN4O4 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 3-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4,8-trione |
| SMILES | O=C1CCC2(CC1)NC(=O)N(CC(=O)N1CCN(c3cccc(Cl)c3)CC1)C2=O |
| InChI | InChI=1S/C20H23ClN4O4/c21-14-2-1-3-15(12-14)23-8-10-24(11-9-23)17(27)13-25-18(28)20(22-19(25)29)6-4-16(26)5-7-20/h1-3,12H,4-11,13H2,(H,22,29) |
| InChIKey | JHEDHXSKYOYAMN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|