C21H27ClN4O3 — CID 9146026
(5S,6R)-3-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 9146026) has the molecular formula C21H27ClN4O3 and a molecular weight of 418.93 g/mol. Its IUPAC name is (5S,6R)-3-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5S,6R)-3-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 9146026 |
| Molecular Formula | C21H27ClN4O3 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (5S,6R)-3-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@@H]1CCCC[C@]12NC(=O)N(CC(=O)N1CCN(c3cccc(Cl)c3)CC1)C2=O |
| InChI | InChI=1S/C21H27ClN4O3/c1-15-5-2-3-8-21(15)19(28)26(20(29)23-21)14-18(27)25-11-9-24(10-12-25)17-7-4-6-16(22)13-17/h4,6-7,13,15H,2-3,5,8-12,14H2,1H3,(H,23,29)/t15-,21+/m1/s1 |
| InChIKey | KWWLKVNGHMWHIB-VFNWGFHPSA-N |
| XLogP | 2.49 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|