C23H32N4O4 — CID 9415287
(5R,6R)-3-[2-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-oxoethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 9415287) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is (5R,6R)-3-[2-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-oxoethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,6R)-3-[2-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-oxoethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 9415287 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | (5R,6R)-3-[2-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-oxoethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CCOc1ccccc1N1CCN(C(=O)CN2C(=O)N[C@@]3(CCCC[C@H]3C)C2=O)CC1 |
| InChI | InChI=1S/C23H32N4O4/c1-3-31-19-10-5-4-9-18(19)25-12-14-26(15-13-25)20(28)16-27-21(29)23(24-22(27)30)11-7-6-8-17(23)2/h4-5,9-10,17H,3,6-8,11-16H2,1-2H3,(H,24,30)/t17-,23-/m1/s1 |
| InChIKey | ZAZVKLXUQOQUQD-UZUQRXQVSA-N |
| XLogP | 2.23 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|