C18H20ClN3O3 — CID 8886506
[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 1-methylpyrrole-2-carboxylate (PubChem CID 8886506) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is [2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 1-methylpyrrole-2-carboxylate.
| Compound Name | [2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 8886506 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | [2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
| SMILES | Cn1cccc1C(=O)OCC(=O)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H20ClN3O3/c1-20-7-3-6-16(20)18(24)25-13-17(23)22-10-8-21(9-11-22)15-5-2-4-14(19)12-15/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | KIXGDNKBTHIFIP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |