C21H26ClN3S — CID 17270323
N-(4-butan-2-ylphenyl)-4-(3-chlorophenyl)piperazine-1-carbothioamide (PubChem CID 17270323) has the molecular formula C21H26ClN3S and a molecular weight of 387.98 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-4-(3-chlorophenyl)piperazine-1-carbothioamide.
| Compound Name | N-(4-butan-2-ylphenyl)-4-(3-chlorophenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17270323 |
| Molecular Formula | C21H26ClN3S |
| Molecular Weight | 387.98 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-4-(3-chlorophenyl)piperazine-1-carbothioamide |
| SMILES | CCC(C)c1ccc(NC(=S)N2CCN(c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C21H26ClN3S/c1-3-16(2)17-7-9-19(10-8-17)23-21(26)25-13-11-24(12-14-25)20-6-4-5-18(22)15-20/h4-10,15-16H,3,11-14H2,1-2H3,(H,23,26) |
| InChIKey | XMQKXEQIEQZJTP-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.98 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|