C21H27N3O — CID 40635402
N-[4-[(2S)-butan-2-yl]phenyl]-4-phenylpiperazine-1-carboxamide (PubChem CID 40635402) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is N-[4-[(2S)-butan-2-yl]phenyl]-4-phenylpiperazine-1-carboxamide.
| Compound Name | N-[4-[(2S)-butan-2-yl]phenyl]-4-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 40635402 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | N-[4-[(2S)-butan-2-yl]phenyl]-4-phenylpiperazine-1-carboxamide |
| SMILES | CC[C@H](C)c1ccc(NC(=O)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H27N3O/c1-3-17(2)18-9-11-19(12-10-18)22-21(25)24-15-13-23(14-16-24)20-7-5-4-6-8-20/h4-12,17H,3,13-16H2,1-2H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | YELSBTGBKLWILH-KRWDZBQOSA-N |
| XLogP | 4.55 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |