C26H36N4O3 — CID 69451467
tert-butyl 4-[4-[(4-butan-2-ylphenyl)carbamoylamino]phenyl]piperazine-1-carboxylate (PubChem CID 69451467) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is tert-butyl 4-[4-[(4-butan-2-ylphenyl)carbamoylamino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(4-butan-2-ylphenyl)carbamoylamino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 69451467 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | tert-butyl 4-[4-[(4-butan-2-ylphenyl)carbamoylamino]phenyl]piperazine-1-carboxylate |
| SMILES | CCC(C)c1ccc(NC(=O)Nc2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H36N4O3/c1-6-19(2)20-7-9-21(10-8-20)27-24(31)28-22-11-13-23(14-12-22)29-15-17-30(18-16-29)25(32)33-26(3,4)5/h7-14,19H,6,15-18H2,1-5H3,(H2,27,28,31) |
| InChIKey | LTWWSHBIYAOCAZ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|