C23H30N4O3S — CID 69449605
tert-butyl 4-[4-[(2-methylsulfanylphenyl)carbamoylamino]phenyl]piperazine-1-carboxylate (PubChem CID 69449605) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is tert-butyl 4-[4-[(2-methylsulfanylphenyl)carbamoylamino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(2-methylsulfanylphenyl)carbamoylamino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 69449605 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | tert-butyl 4-[4-[(2-methylsulfanylphenyl)carbamoylamino]phenyl]piperazine-1-carboxylate |
| SMILES | CSc1ccccc1NC(=O)Nc1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H30N4O3S/c1-23(2,3)30-22(29)27-15-13-26(14-16-27)18-11-9-17(10-12-18)24-21(28)25-19-7-5-6-8-20(19)31-4/h5-12H,13-16H2,1-4H3,(H2,24,25,28) |
| InChIKey | UDDNVDIUFRANND-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|