C22H29N5O4 — CID 69454140
tert-butyl 4-[5-[(2-methoxyphenyl)carbamoylamino]-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 69454140) has the molecular formula C22H29N5O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is tert-butyl 4-[5-[(2-methoxyphenyl)carbamoylamino]-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[(2-methoxyphenyl)carbamoylamino]-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 69454140 |
| Molecular Formula | C22H29N5O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | tert-butyl 4-[5-[(2-methoxyphenyl)carbamoylamino]-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | COc1ccccc1NC(=O)Nc1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)nc1 |
| InChI | InChI=1S/C22H29N5O4/c1-22(2,3)31-21(29)27-13-11-26(12-14-27)19-10-9-16(15-23-19)24-20(28)25-17-7-5-6-8-18(17)30-4/h5-10,15H,11-14H2,1-4H3,(H2,24,25,28) |
| InChIKey | MDVZBRSCRUPDFJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |