C14H22N4O3 — CID 143289183
tert-butyl 4-[5-(hydroxyamino)-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 143289183) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is tert-butyl 4-[5-(hydroxyamino)-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-(hydroxyamino)-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 143289183 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | tert-butyl 4-[5-(hydroxyamino)-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(NO)cn2)CC1 |
| InChI | InChI=1S/C14H22N4O3/c1-14(2,3)21-13(19)18-8-6-17(7-9-18)12-5-4-11(16-20)10-15-12/h4-5,10,16,20H,6-9H2,1-3H3 |
| InChIKey | KQBVEYNHVUQIGU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|