C19H27N5O4 — CID 146523656
tert-butyl 4-[5-[(2,6-dioxopiperidin-3-yl)amino]-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 146523656) has the molecular formula C19H27N5O4 and a molecular weight of 389.46 g/mol. Its IUPAC name is tert-butyl 4-[5-[(2,6-dioxopiperidin-3-yl)amino]-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[(2,6-dioxopiperidin-3-yl)amino]-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 146523656 |
| Molecular Formula | C19H27N5O4 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | tert-butyl 4-[5-[(2,6-dioxopiperidin-3-yl)amino]-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(NC3CCC(=O)NC3=O)cn2)CC1 |
| InChI | InChI=1S/C19H27N5O4/c1-19(2,3)28-18(27)24-10-8-23(9-11-24)15-6-4-13(12-20-15)21-14-5-7-16(25)22-17(14)26/h4,6,12,14,21H,5,7-11H2,1-3H3,(H,22,25,26) |
| InChIKey | KUAGMBOABFUJRK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|