C21H28FN3O4 — CID 156505960
tert-butyl 4-[4-[[(3R)-2,6-dioxopiperidin-3-yl]amino]-2-fluorophenyl]piperidine-1-carboxylate (PubChem CID 156505960) has the molecular formula C21H28FN3O4 and a molecular weight of 405.47 g/mol. Its IUPAC name is tert-butyl 4-[4-[[(3R)-2,6-dioxopiperidin-3-yl]amino]-2-fluorophenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[(3R)-2,6-dioxopiperidin-3-yl]amino]-2-fluorophenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 156505960 |
| Molecular Formula | C21H28FN3O4 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | tert-butyl 4-[4-[[(3R)-2,6-dioxopiperidin-3-yl]amino]-2-fluorophenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(N[C@@H]3CCC(=O)NC3=O)cc2F)CC1 |
| InChI | InChI=1S/C21H28FN3O4/c1-21(2,3)29-20(28)25-10-8-13(9-11-25)15-5-4-14(12-16(15)22)23-17-6-7-18(26)24-19(17)27/h4-5,12-13,17,23H,6-11H2,1-3H3,(H,24,26,27)/t17-/m1/s1 |
| InChIKey | UNIAEKPSHZFHLK-QGZVFWFLSA-N |
| XLogP | 3.16 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|