C21H27F3N4O4 — CID 167463168
tert-butyl 4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate (PubChem CID 167463168) has the molecular formula C21H27F3N4O4 and a molecular weight of 456.47 g/mol. Its IUPAC name is tert-butyl 4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167463168 |
| Molecular Formula | C21H27F3N4O4 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | tert-butyl 4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(NC3CCC(=O)NC3=O)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H27F3N4O4/c1-20(2,3)32-19(31)28-10-8-27(9-11-28)16-6-4-13(12-14(16)21(22,23)24)25-15-5-7-17(29)26-18(15)30/h4,6,12,15,25H,5,7-11H2,1-3H3,(H,26,29,30) |
| InChIKey | GORIWVYVVZVQOC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|