C23H30F3N5O4 — CID 164720173
3-[4-[4-hydroxy-4-(2-oxo-2-piperazin-1-ylethyl)piperidin-1-yl]-3-(trifluoromethyl)anilino]piperidine-2,6-dione (PubChem CID 164720173) has the molecular formula C23H30F3N5O4 and a molecular weight of 497.52 g/mol. Its IUPAC name is 3-[4-[4-hydroxy-4-(2-oxo-2-piperazin-1-ylethyl)piperidin-1-yl]-3-(trifluoromethyl)anilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-hydroxy-4-(2-oxo-2-piperazin-1-ylethyl)piperidin-1-yl]-3-(trifluoromethyl)anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164720173 |
| Molecular Formula | C23H30F3N5O4 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 3-[4-[4-hydroxy-4-(2-oxo-2-piperazin-1-ylethyl)piperidin-1-yl]-3-(trifluoromethyl)anilino]piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2ccc(N3CCC(O)(CC(=O)N4CCNCC4)CC3)c(C(F)(F)F)c2)C(=O)N1 |
| InChI | InChI=1S/C23H30F3N5O4/c24-23(25,26)16-13-15(28-17-2-4-19(32)29-21(17)34)1-3-18(16)30-9-5-22(35,6-10-30)14-20(33)31-11-7-27-8-12-31/h1,3,13,17,27-28,35H,2,4-12,14H2,(H,29,32,34) |
| InChIKey | OKBNQVXSIBOWPQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|