C22H30FN3O5 — CID 156506261
tert-butyl 2-[1-[4-[[(3S)-2,6-dioxopiperidin-3-yl]amino]-2-fluorophenyl]-4-hydroxypiperidin-4-yl]acetate (PubChem CID 156506261) has the molecular formula C22H30FN3O5 and a molecular weight of 435.50 g/mol. Its IUPAC name is tert-butyl 2-[1-[4-[[(3S)-2,6-dioxopiperidin-3-yl]amino]-2-fluorophenyl]-4-hydroxypiperidin-4-yl]acetate.
| Compound Name | tert-butyl 2-[1-[4-[[(3S)-2,6-dioxopiperidin-3-yl]amino]-2-fluorophenyl]-4-hydroxypiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 156506261 |
| Molecular Formula | C22H30FN3O5 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | tert-butyl 2-[1-[4-[[(3S)-2,6-dioxopiperidin-3-yl]amino]-2-fluorophenyl]-4-hydroxypiperidin-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1(O)CCN(c2ccc(N[C@H]3CCC(=O)NC3=O)cc2F)CC1 |
| InChI | InChI=1S/C22H30FN3O5/c1-21(2,3)31-19(28)13-22(30)8-10-26(11-9-22)17-6-4-14(12-15(17)23)24-16-5-7-18(27)25-20(16)29/h4,6,12,16,24,30H,5,7-11,13H2,1-3H3,(H,25,27,29)/t16-/m0/s1 |
| InChIKey | NZXYSNOPAYAIDT-INIZCTEOSA-N |
| XLogP | 2.11 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|