C20H28FN3O4 — CID 176706048
3-[4-[4-(2,2-dimethoxyethyl)piperidin-1-yl]-3-fluoroanilino]piperidine-2,6-dione (PubChem CID 176706048) has the molecular formula C20H28FN3O4 and a molecular weight of 393.46 g/mol. Its IUPAC name is 3-[4-[4-(2,2-dimethoxyethyl)piperidin-1-yl]-3-fluoroanilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-(2,2-dimethoxyethyl)piperidin-1-yl]-3-fluoroanilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176706048 |
| Molecular Formula | C20H28FN3O4 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 3-[4-[4-(2,2-dimethoxyethyl)piperidin-1-yl]-3-fluoroanilino]piperidine-2,6-dione |
| SMILES | COC(CC1CCN(c2ccc(NC3CCC(=O)NC3=O)cc2F)CC1)OC |
| InChI | InChI=1S/C20H28FN3O4/c1-27-19(28-2)11-13-7-9-24(10-8-13)17-5-3-14(12-15(17)21)22-16-4-6-18(25)23-20(16)26/h3,5,12-13,16,19,22H,4,6-11H2,1-2H3,(H,23,25,26) |
| InChIKey | NOUMMUZEIWBRMU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|