C18H25FN4O3 — CID 170953248
3-[3-fluoro-4-[3-(methoxymethyl)-4-methylpiperazin-1-yl]anilino]piperidine-2,6-dione (PubChem CID 170953248) has the molecular formula C18H25FN4O3 and a molecular weight of 364.42 g/mol. Its IUPAC name is 3-[3-fluoro-4-[3-(methoxymethyl)-4-methylpiperazin-1-yl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[3-fluoro-4-[3-(methoxymethyl)-4-methylpiperazin-1-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170953248 |
| Molecular Formula | C18H25FN4O3 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 3-[3-fluoro-4-[3-(methoxymethyl)-4-methylpiperazin-1-yl]anilino]piperidine-2,6-dione |
| SMILES | COCC1CN(c2ccc(NC3CCC(=O)NC3=O)cc2F)CCN1C |
| InChI | InChI=1S/C18H25FN4O3/c1-22-7-8-23(10-13(22)11-26-2)16-5-3-12(9-14(16)19)20-15-4-6-17(24)21-18(15)25/h3,5,9,13,15,20H,4,6-8,10-11H2,1-2H3,(H,21,24,25) |
| InChIKey | NFHIRODEYABGEI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|