C20H27FN4O4 — CID 171637309
5-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperazin-1-yl]pentanoic acid (PubChem CID 171637309) has the molecular formula C20H27FN4O4 and a molecular weight of 406.46 g/mol. Its IUPAC name is 5-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperazin-1-yl]pentanoic acid.
| Compound Name | 5-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperazin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 171637309 |
| Molecular Formula | C20H27FN4O4 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 5-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperazin-1-yl]pentanoic acid |
| SMILES | O=C(O)CCCCN1CCN(c2ccc(NC3CCC(=O)NC3=O)cc2F)CC1 |
| InChI | InChI=1S/C20H27FN4O4/c21-15-13-14(22-16-5-7-18(26)23-20(16)29)4-6-17(15)25-11-9-24(10-12-25)8-2-1-3-19(27)28/h4,6,13,16,22H,1-3,5,7-12H2,(H,27,28)(H,23,26,29) |
| InChIKey | CWGFKWSASKVNKN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|