C26H36FN5O3 — CID 166168049
3-[4-[4-[2-(8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]piperazin-1-yl]-3-fluoroanilino]piperidine-2,6-dione (PubChem CID 166168049) has the molecular formula C26H36FN5O3 and a molecular weight of 485.60 g/mol. Its IUPAC name is 3-[4-[4-[2-(8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]piperazin-1-yl]-3-fluoroanilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[2-(8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]piperazin-1-yl]-3-fluoroanilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166168049 |
| Molecular Formula | C26H36FN5O3 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | 3-[4-[4-[2-(8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]piperazin-1-yl]-3-fluoroanilino]piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2ccc(N3CCN(CC(=O)N4CCC5(CCCC5)CC4)CC3)c(F)c2)C(=O)N1 |
| InChI | InChI=1S/C26H36FN5O3/c27-20-17-19(28-21-4-6-23(33)29-25(21)35)3-5-22(20)31-15-13-30(14-16-31)18-24(34)32-11-9-26(10-12-32)7-1-2-8-26/h3,5,17,21,28H,1-2,4,6-16,18H2,(H,29,33,35) |
| InChIKey | SICXCEZALKYFES-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|