C27H36F2N4O3 — CID 175831310
(3S)-3-[4-[1-[2-(8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]piperidin-4-yl]-2,3-difluoroanilino]piperidine-2,6-dione (PubChem CID 175831310) has the molecular formula C27H36F2N4O3 and a molecular weight of 502.61 g/mol. Its IUPAC name is (3S)-3-[4-[1-[2-(8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]piperidin-4-yl]-2,3-difluoroanilino]piperidine-2,6-dione.
| Compound Name | (3S)-3-[4-[1-[2-(8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]piperidin-4-yl]-2,3-difluoroanilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175831310 |
| Molecular Formula | C27H36F2N4O3 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | (3S)-3-[4-[1-[2-(8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]piperidin-4-yl]-2,3-difluoroanilino]piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](Nc2ccc(C3CCN(CC(=O)N4CCC5(CCCC5)CC4)CC3)c(F)c2F)C(=O)N1 |
| InChI | InChI=1S/C27H36F2N4O3/c28-24-19(3-4-20(25(24)29)30-21-5-6-22(34)31-26(21)36)18-7-13-32(14-8-18)17-23(35)33-15-11-27(12-16-33)9-1-2-10-27/h3-4,18,21,30H,1-2,5-17H2,(H,31,34,36)/t21-/m0/s1 |
| InChIKey | GYBWKDJUSVOWLQ-NRFANRHFSA-N |
| XLogP | 3.54 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|