C18H24ClN3O4 — CID 175756578
2-[4-[4-[[(3R)-2,6-dioxopiperidin-3-yl]amino]phenyl]piperidin-1-yl]acetic acid;hydrochloride (PubChem CID 175756578) has the molecular formula C18H24ClN3O4 and a molecular weight of 381.86 g/mol. Its IUPAC name is 2-[4-[4-[[(3R)-2,6-dioxopiperidin-3-yl]amino]phenyl]piperidin-1-yl]acetic acid;hydrochloride.
| Compound Name | 2-[4-[4-[[(3R)-2,6-dioxopiperidin-3-yl]amino]phenyl]piperidin-1-yl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 175756578 |
| Molecular Formula | C18H24ClN3O4 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-[4-[4-[[(3R)-2,6-dioxopiperidin-3-yl]amino]phenyl]piperidin-1-yl]acetic acid;hydrochloride |
| SMILES | Cl.O=C(O)CN1CCC(c2ccc(N[C@@H]3CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C18H23N3O4.ClH/c22-16-6-5-15(18(25)20-16)19-14-3-1-12(2-4-14)13-7-9-21(10-8-13)11-17(23)24;/h1-4,13,15,19H,5-11H2,(H,23,24)(H,20,22,25);1H/t15-;/m1./s1 |
| InChIKey | OWKQCNIRJYIBSB-XFULWGLBSA-N |
| XLogP | 1.59 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|