C17H21N3O4 — CID 166900322
2-[4-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperidin-1-yl]acetic acid (PubChem CID 166900322) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-[4-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 166900322 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-[4-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCC(c2ccc(N3CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C17H21N3O4/c21-15-7-10-20(17(24)18-15)14-3-1-12(2-4-14)13-5-8-19(9-6-13)11-16(22)23/h1-4,13H,5-11H2,(H,22,23)(H,18,21,24) |
| InChIKey | JLKPVZGTUGIBTK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |