C18H22FN3O4 — CID 175548556
2-[4-[3-amino-4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]piperidin-1-yl]acetic acid (PubChem CID 175548556) has the molecular formula C18H22FN3O4 and a molecular weight of 363.39 g/mol. Its IUPAC name is 2-[4-[3-amino-4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[3-amino-4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 175548556 |
| Molecular Formula | C18H22FN3O4 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-[4-[3-amino-4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]piperidin-1-yl]acetic acid |
| SMILES | Nc1c(C2CCC(=O)NC2=O)ccc(C2CCN(CC(=O)O)CC2)c1F |
| InChI | InChI=1S/C18H22FN3O4/c19-16-11(10-5-7-22(8-6-10)9-15(24)25)1-2-12(17(16)20)13-3-4-14(23)21-18(13)26/h1-2,10,13H,3-9,20H2,(H,24,25)(H,21,23,26) |
| InChIKey | UYTMLZHPTRYDNI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|