C17H21FN3O4Si — CID 166168961
CID 166168961 (PubChem CID 166168961) has the molecular formula C17H21FN3O4Si and a molecular weight of 378.46 g/mol.
| Compound Name | CID 166168961 |
|---|---|
| PubChem CID | 166168961 |
| Molecular Formula | C17H21FN3O4Si |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | — |
| SMILES | O=C(O)CN1CCC(c2ccc(N[Si]3CCC(=O)NC3=O)cc2F)CC1 |
| InChI | InChI=1S/C17H21FN3O4Si/c18-14-9-12(20-26-8-5-15(22)19-17(26)25)1-2-13(14)11-3-6-21(7-4-11)10-16(23)24/h1-2,9,11,20H,3-8,10H2,(H,23,24)(H,19,22,25) |
| InChIKey | FNFGNYRBNWIDQT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|