C19H23F3N4O6 — CID 175584631
2-[4-[5-[(2,6-dioxopiperidin-3-yl)amino]-2-pyridinyl]piperidin-1-yl]acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 175584631) has the molecular formula C19H23F3N4O6 and a molecular weight of 460.41 g/mol. Its IUPAC name is 2-[4-[5-[(2,6-dioxopiperidin-3-yl)amino]-2-pyridinyl]piperidin-1-yl]acetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-[5-[(2,6-dioxopiperidin-3-yl)amino]-2-pyridinyl]piperidin-1-yl]acetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175584631 |
| Molecular Formula | C19H23F3N4O6 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-[4-[5-[(2,6-dioxopiperidin-3-yl)amino]-2-pyridinyl]piperidin-1-yl]acetic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CN1CCC(c2ccc(NC3CCC(=O)NC3=O)cn2)CC1 |
| InChI | InChI=1S/C17H22N4O4.C2HF3O2/c22-15-4-3-14(17(25)20-15)19-12-1-2-13(18-9-12)11-5-7-21(8-6-11)10-16(23)24;3-2(4,5)1(6)7/h1-2,9,11,14,19H,3-8,10H2,(H,23,24)(H,20,22,25);(H,6,7) |
| InChIKey | ZFMJFLHCTJVBOX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|