C19H27N5O3 — CID 166472189
3-[[5-[1-(3-methyl-2-oxobutyl)piperidin-4-yl]pyrimidin-2-yl]amino]piperidine-2,6-dione (PubChem CID 166472189) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is 3-[[5-[1-(3-methyl-2-oxobutyl)piperidin-4-yl]pyrimidin-2-yl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[5-[1-(3-methyl-2-oxobutyl)piperidin-4-yl]pyrimidin-2-yl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166472189 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 3-[[5-[1-(3-methyl-2-oxobutyl)piperidin-4-yl]pyrimidin-2-yl]amino]piperidine-2,6-dione |
| SMILES | CC(C)C(=O)CN1CCC(c2cnc(NC3CCC(=O)NC3=O)nc2)CC1 |
| InChI | InChI=1S/C19H27N5O3/c1-12(2)16(25)11-24-7-5-13(6-8-24)14-9-20-19(21-10-14)22-15-3-4-17(26)23-18(15)27/h9-10,12-13,15H,3-8,11H2,1-2H3,(H,20,21,22)(H,23,26,27) |
| InChIKey | JUMVHNTWFUVKPP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|