C17H29N3O2 — CID 170749748
ethane;3-[(5-propan-2-yl-2-pyridinyl)amino]piperidine-2,6-dione (PubChem CID 170749748) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is ethane;3-[(5-propan-2-yl-2-pyridinyl)amino]piperidine-2,6-dione.
| Compound Name | ethane;3-[(5-propan-2-yl-2-pyridinyl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170749748 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | ethane;3-[(5-propan-2-yl-2-pyridinyl)amino]piperidine-2,6-dione |
| SMILES | CC.CC.CC(C)c1ccc(NC2CCC(=O)NC2=O)nc1 |
| InChI | InChI=1S/C13H17N3O2.2C2H6/c1-8(2)9-3-5-11(14-7-9)15-10-4-6-12(17)16-13(10)18;2*1-2/h3,5,7-8,10H,4,6H2,1-2H3,(H,14,15)(H,16,17,18);2*1-2H3 |
| InChIKey | INHJEPCGOFHJMF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|