C12H16N4O2 — CID 177356085
3-[(6-propan-2-ylpyridazin-3-yl)amino]piperidine-2,6-dione (PubChem CID 177356085) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 3-[(6-propan-2-ylpyridazin-3-yl)amino]piperidine-2,6-dione.
| Compound Name | 3-[(6-propan-2-ylpyridazin-3-yl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177356085 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-[(6-propan-2-ylpyridazin-3-yl)amino]piperidine-2,6-dione |
| SMILES | CC(C)c1ccc(NC2CCC(=O)NC2=O)nn1 |
| InChI | InChI=1S/C12H16N4O2/c1-7(2)8-3-5-10(16-15-8)13-9-4-6-11(17)14-12(9)18/h3,5,7,9H,4,6H2,1-2H3,(H,13,16)(H,14,17,18) |
| InChIKey | ALDQZJKFCKMKDL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|