C16H24N2O2 — CID 170749152
ethane;3-(4-propan-2-ylanilino)piperidine-2,6-dione (PubChem CID 170749152) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is ethane;3-(4-propan-2-ylanilino)piperidine-2,6-dione.
| Compound Name | ethane;3-(4-propan-2-ylanilino)piperidine-2,6-dione |
|---|---|
| PubChem CID | 170749152 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | ethane;3-(4-propan-2-ylanilino)piperidine-2,6-dione |
| SMILES | CC.CC(C)c1ccc(NC2CCC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C14H18N2O2.C2H6/c1-9(2)10-3-5-11(6-4-10)15-12-7-8-13(17)16-14(12)18;1-2/h3-6,9,12,15H,7-8H2,1-2H3,(H,16,17,18);1-2H3 |
| InChIKey | IJSLCIHDIQXVQL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|