C19H25F2N3O2 — CID 166116748
3-[4-(3,3-difluoro-1-propan-2-ylpiperidin-4-yl)anilino]piperidine-2,6-dione (PubChem CID 166116748) has the molecular formula C19H25F2N3O2 and a molecular weight of 365.42 g/mol. Its IUPAC name is 3-[4-(3,3-difluoro-1-propan-2-ylpiperidin-4-yl)anilino]piperidine-2,6-dione.
| Compound Name | 3-[4-(3,3-difluoro-1-propan-2-ylpiperidin-4-yl)anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166116748 |
| Molecular Formula | C19H25F2N3O2 |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 3-[4-(3,3-difluoro-1-propan-2-ylpiperidin-4-yl)anilino]piperidine-2,6-dione |
| SMILES | CC(C)N1CCC(c2ccc(NC3CCC(=O)NC3=O)cc2)C(F)(F)C1 |
| InChI | InChI=1S/C19H25F2N3O2/c1-12(2)24-10-9-15(19(20,21)11-24)13-3-5-14(6-4-13)22-16-7-8-17(25)23-18(16)26/h3-6,12,15-16,22H,7-11H2,1-2H3,(H,23,25,26) |
| InChIKey | WLYIPPBPUMPQJK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|