C21H31N3O2 — CID 166117135
3-[4-(2,2-dimethyl-1-propan-2-ylpiperidin-4-yl)anilino]piperidine-2,6-dione (PubChem CID 166117135) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 3-[4-(2,2-dimethyl-1-propan-2-ylpiperidin-4-yl)anilino]piperidine-2,6-dione.
| Compound Name | 3-[4-(2,2-dimethyl-1-propan-2-ylpiperidin-4-yl)anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166117135 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 3-[4-(2,2-dimethyl-1-propan-2-ylpiperidin-4-yl)anilino]piperidine-2,6-dione |
| SMILES | CC(C)N1CCC(c2ccc(NC3CCC(=O)NC3=O)cc2)CC1(C)C |
| InChI | InChI=1S/C21H31N3O2/c1-14(2)24-12-11-16(13-21(24,3)4)15-5-7-17(8-6-15)22-18-9-10-19(25)23-20(18)26/h5-8,14,16,18,22H,9-13H2,1-4H3,(H,23,25,26) |
| InChIKey | KLLZQVRSCDKUEZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|