C23H31N3O4 — CID 166116816
tert-butyl (7R)-7-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-4-azaspiro[2.5]octane-4-carboxylate (PubChem CID 166116816) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is tert-butyl (7R)-7-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-4-azaspiro[2.5]octane-4-carboxylate.
| Compound Name | tert-butyl (7R)-7-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-4-azaspiro[2.5]octane-4-carboxylate |
|---|---|
| PubChem CID | 166116816 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | tert-butyl (7R)-7-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-4-azaspiro[2.5]octane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](c2ccc(NC3CCC(=O)NC3=O)cc2)CC12CC2 |
| InChI | InChI=1S/C23H31N3O4/c1-22(2,3)30-21(29)26-13-10-16(14-23(26)11-12-23)15-4-6-17(7-5-15)24-18-8-9-19(27)25-20(18)28/h4-7,16,18,24H,8-14H2,1-3H3,(H,25,27,28)/t16-,18?/m1/s1 |
| InChIKey | RHJWKIDNQNFCRP-PYUWXLGESA-N |
| XLogP | 3.55 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|