C28H42N4O4 — CID 172591640
tert-butyl 4-[2-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidin-1-yl]ethyl]piperidine-1-carboxylate (PubChem CID 172591640) has the molecular formula C28H42N4O4 and a molecular weight of 498.67 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidin-1-yl]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidin-1-yl]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172591640 |
| Molecular Formula | C28H42N4O4 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | tert-butyl 4-[2-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidin-1-yl]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCN2CCC(c3ccc(NC4CCC(=O)NC4=O)cc3)CC2)CC1 |
| InChI | InChI=1S/C28H42N4O4/c1-28(2,3)36-27(35)32-18-11-20(12-19-32)10-15-31-16-13-22(14-17-31)21-4-6-23(7-5-21)29-24-8-9-25(33)30-26(24)34/h4-7,20,22,24,29H,8-19H2,1-3H3,(H,30,33,34) |
| InChIKey | STTNBAUXSHWBKN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|