C25H38N6O4 — CID 177300780
tert-butyl 4-[[4-[6-[(2,6-dioxopiperidin-3-yl)amino]-3-pyridinyl]piperazin-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 177300780) has the molecular formula C25H38N6O4 and a molecular weight of 486.62 g/mol. Its IUPAC name is tert-butyl 4-[[4-[6-[(2,6-dioxopiperidin-3-yl)amino]-3-pyridinyl]piperazin-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[6-[(2,6-dioxopiperidin-3-yl)amino]-3-pyridinyl]piperazin-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 177300780 |
| Molecular Formula | C25H38N6O4 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | tert-butyl 4-[[4-[6-[(2,6-dioxopiperidin-3-yl)amino]-3-pyridinyl]piperazin-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CN2CCN(c3ccc(NC4CCC(=O)NC4=O)nc3)CC2)CC1 |
| InChI | InChI=1S/C25H38N6O4/c1-25(2,3)35-24(34)31-10-8-18(9-11-31)17-29-12-14-30(15-13-29)19-4-6-21(26-16-19)27-20-5-7-22(32)28-23(20)33/h4,6,16,18,20H,5,7-15,17H2,1-3H3,(H,26,27)(H,28,32,33) |
| InChIKey | QRCWNTAFBILQRY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|