C26H37FN4O4 — CID 177363904
tert-butyl 4-[[4-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]piperazin-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 177363904) has the molecular formula C26H37FN4O4 and a molecular weight of 488.60 g/mol. Its IUPAC name is tert-butyl 4-[[4-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]piperazin-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]piperazin-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 177363904 |
| Molecular Formula | C26H37FN4O4 |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | tert-butyl 4-[[4-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]piperazin-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CN2CCN(c3ccc(C4CCC(=O)NC4=O)cc3F)CC2)CC1 |
| InChI | InChI=1S/C26H37FN4O4/c1-26(2,3)35-25(34)31-10-8-18(9-11-31)17-29-12-14-30(15-13-29)22-6-4-19(16-21(22)27)20-5-7-23(32)28-24(20)33/h4,6,16,18,20H,5,7-15,17H2,1-3H3,(H,28,32,33) |
| InChIKey | KKCQOKPNAPLYMW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|