C24H32F4N4O3 — CID 177364562
3-[3-fluoro-4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]phenyl]piperidine-2,6-dione;3,3,3-trifluoroprop-1-en-2-ol (PubChem CID 177364562) has the molecular formula C24H32F4N4O3 and a molecular weight of 500.54 g/mol. Its IUPAC name is 3-[3-fluoro-4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]phenyl]piperidine-2,6-dione;3,3,3-trifluoroprop-1-en-2-ol.
| Compound Name | 3-[3-fluoro-4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]phenyl]piperidine-2,6-dione;3,3,3-trifluoroprop-1-en-2-ol |
|---|---|
| PubChem CID | 177364562 |
| Molecular Formula | C24H32F4N4O3 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 3-[3-fluoro-4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]phenyl]piperidine-2,6-dione;3,3,3-trifluoroprop-1-en-2-ol |
| SMILES | C=C(O)C(F)(F)F.O=C1CCC(c2ccc(N3CCN(CC4CCNCC4)CC3)c(F)c2)C(=O)N1 |
| InChI | InChI=1S/C21H29FN4O2.C3H3F3O/c22-18-13-16(17-2-4-20(27)24-21(17)28)1-3-19(18)26-11-9-25(10-12-26)14-15-5-7-23-8-6-15;1-2(7)3(4,5)6/h1,3,13,15,17,23H,2,4-12,14H2,(H,24,27,28);7H,1H2 |
| InChIKey | WXDWIDCFWSWCRT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|