C18H20F4N2O4 — CID 175829694
3-(3-fluoro-4-piperidin-4-ylphenyl)piperidine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 175829694) has the molecular formula C18H20F4N2O4 and a molecular weight of 404.36 g/mol. Its IUPAC name is 3-(3-fluoro-4-piperidin-4-ylphenyl)piperidine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(3-fluoro-4-piperidin-4-ylphenyl)piperidine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175829694 |
| Molecular Formula | C18H20F4N2O4 |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 3-(3-fluoro-4-piperidin-4-ylphenyl)piperidine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1CCC(c2ccc(C3CCNCC3)c(F)c2)C(=O)N1 |
| InChI | InChI=1S/C16H19FN2O2.C2HF3O2/c17-14-9-11(13-3-4-15(20)19-16(13)21)1-2-12(14)10-5-7-18-8-6-10;3-2(4,5)1(6)7/h1-2,9-10,13,18H,3-8H2,(H,19,20,21);(H,6,7) |
| InChIKey | OHTJUYVQTFPXJS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|