C16H20FN3O2 — CID 156505691
3-(2-fluoro-4-piperidin-4-ylanilino)piperidine-2,6-dione (PubChem CID 156505691) has the molecular formula C16H20FN3O2 and a molecular weight of 305.35 g/mol. Its IUPAC name is 3-(2-fluoro-4-piperidin-4-ylanilino)piperidine-2,6-dione.
| Compound Name | 3-(2-fluoro-4-piperidin-4-ylanilino)piperidine-2,6-dione |
|---|---|
| PubChem CID | 156505691 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 3-(2-fluoro-4-piperidin-4-ylanilino)piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2ccc(C3CCNCC3)cc2F)C(=O)N1 |
| InChI | InChI=1S/C16H20FN3O2/c17-12-9-11(10-5-7-18-8-6-10)1-2-13(12)19-14-3-4-15(21)20-16(14)22/h1-2,9-10,14,18-19H,3-8H2,(H,20,21,22) |
| InChIKey | ZBNFMBRJHAHDFF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|