C17H22FN3O2 — CID 166116987
3-[2-fluoro-4-(1-methylpiperidin-4-yl)anilino]piperidine-2,6-dione (PubChem CID 166116987) has the molecular formula C17H22FN3O2 and a molecular weight of 319.38 g/mol. Its IUPAC name is 3-[2-fluoro-4-(1-methylpiperidin-4-yl)anilino]piperidine-2,6-dione.
| Compound Name | 3-[2-fluoro-4-(1-methylpiperidin-4-yl)anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166116987 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 3-[2-fluoro-4-(1-methylpiperidin-4-yl)anilino]piperidine-2,6-dione |
| SMILES | CN1CCC(c2ccc(NC3CCC(=O)NC3=O)c(F)c2)CC1 |
| InChI | InChI=1S/C17H22FN3O2/c1-21-8-6-11(7-9-21)12-2-3-14(13(18)10-12)19-15-4-5-16(22)20-17(15)23/h2-3,10-11,15,19H,4-9H2,1H3,(H,20,22,23) |
| InChIKey | IOIPWZYDGHNJHF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|