C18H24N2O2 — CID 166117430
3-[[4-(1-methylpiperidin-4-yl)phenyl]methyl]piperidine-2,6-dione (PubChem CID 166117430) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-[[4-(1-methylpiperidin-4-yl)phenyl]methyl]piperidine-2,6-dione.
| Compound Name | 3-[[4-(1-methylpiperidin-4-yl)phenyl]methyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166117430 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 3-[[4-(1-methylpiperidin-4-yl)phenyl]methyl]piperidine-2,6-dione |
| SMILES | CN1CCC(c2ccc(CC3CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C18H24N2O2/c1-20-10-8-15(9-11-20)14-4-2-13(3-5-14)12-16-6-7-17(21)19-18(16)22/h2-5,15-16H,6-12H2,1H3,(H,19,21,22) |
| InChIKey | KVCAYZIVEDYLAP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|