C17H21FN2O2 — CID 170953722
3-[2-fluoro-4-(1-methylpiperidin-4-yl)phenyl]piperidine-2,6-dione (PubChem CID 170953722) has the molecular formula C17H21FN2O2 and a molecular weight of 304.37 g/mol. Its IUPAC name is 3-[2-fluoro-4-(1-methylpiperidin-4-yl)phenyl]piperidine-2,6-dione.
| Compound Name | 3-[2-fluoro-4-(1-methylpiperidin-4-yl)phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170953722 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 3-[2-fluoro-4-(1-methylpiperidin-4-yl)phenyl]piperidine-2,6-dione |
| SMILES | CN1CCC(c2ccc(C3CCC(=O)NC3=O)c(F)c2)CC1 |
| InChI | InChI=1S/C17H21FN2O2/c1-20-8-6-11(7-9-20)12-2-3-13(15(18)10-12)14-4-5-16(21)19-17(14)22/h2-3,10-11,14H,4-9H2,1H3,(H,19,21,22) |
| InChIKey | AHLRQEWBZUUUKR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|