C20H26FN3O4 — CID 174235565
3-tert-butyl-4-[4-(2,6-dioxopiperidin-3-yl)-3-fluorophenyl]piperazine-1-carboxylic acid (PubChem CID 174235565) has the molecular formula C20H26FN3O4 and a molecular weight of 391.44 g/mol. Its IUPAC name is 3-tert-butyl-4-[4-(2,6-dioxopiperidin-3-yl)-3-fluorophenyl]piperazine-1-carboxylic acid.
| Compound Name | 3-tert-butyl-4-[4-(2,6-dioxopiperidin-3-yl)-3-fluorophenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 174235565 |
| Molecular Formula | C20H26FN3O4 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 3-tert-butyl-4-[4-(2,6-dioxopiperidin-3-yl)-3-fluorophenyl]piperazine-1-carboxylic acid |
| SMILES | CC(C)(C)C1CN(C(=O)O)CCN1c1ccc(C2CCC(=O)NC2=O)c(F)c1 |
| InChI | InChI=1S/C20H26FN3O4/c1-20(2,3)16-11-23(19(27)28)8-9-24(16)12-4-5-13(15(21)10-12)14-6-7-17(25)22-18(14)26/h4-5,10,14,16H,6-9,11H2,1-3H3,(H,27,28)(H,22,25,26) |
| InChIKey | ZYNROSVEWWMAFU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|