C19H28FNO3Si — CID 168874469
3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-fluorophenyl]piperidine-2,6-dione (PubChem CID 168874469) has the molecular formula C19H28FNO3Si and a molecular weight of 365.52 g/mol. Its IUPAC name is 3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-fluorophenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-fluorophenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168874469 |
| Molecular Formula | C19H28FNO3Si |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-fluorophenyl]piperidine-2,6-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCCc1ccc(C2CCC(=O)NC2=O)c(F)c1 |
| InChI | InChI=1S/C19H28FNO3Si/c1-19(2,3)25(4,5)24-11-10-13-6-7-14(16(20)12-13)15-8-9-17(22)21-18(15)23/h6-7,12,15H,8-11H2,1-5H3,(H,21,22,23) |
| InChIKey | INUSCBYQROJHHW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|