C15H13FN2O2 — CID 164563329
3-(5-fluoro-2-methylquinolin-3-yl)piperidine-2,6-dione (PubChem CID 164563329) has the molecular formula C15H13FN2O2 and a molecular weight of 272.28 g/mol. Its IUPAC name is 3-(5-fluoro-2-methylquinolin-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(5-fluoro-2-methylquinolin-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 164563329 |
| Molecular Formula | C15H13FN2O2 |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3-(5-fluoro-2-methylquinolin-3-yl)piperidine-2,6-dione |
| SMILES | Cc1nc2cccc(F)c2cc1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C15H13FN2O2/c1-8-10(9-5-6-14(19)18-15(9)20)7-11-12(16)3-2-4-13(11)17-8/h2-4,7,9H,5-6H2,1H3,(H,18,19,20) |
| InChIKey | XRPCTUTXNPBJOL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|