About [3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-6-yl] 2-aminoacetate;hydrochloride
[3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-6-yl] 2-aminoacetate;hydrochloride (PubChem CID 175590062) has the molecular formula C17H18ClN3O4
and a molecular weight of 363.80 g/mol. Its IUPAC name is [3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-6-yl] 2-aminoacetate;hydrochloride.
Molecular Properties
| Compound Name | [3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-6-yl] 2-aminoacetate;hydrochloride |
| PubChem CID | 175590062 |
| Molecular Formula | C17H18ClN3O4 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | [3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-6-yl] 2-aminoacetate;hydrochloride |
| SMILES | Cc1nc2ccc(OC(=O)CN)cc2cc1C1CCC(=O)NC1=O.Cl |
| InChI | InChI=1S/C17H17N3O4.ClH/c1-9-13(12-3-5-15(21)20-17(12)23)7-10-6-11(24-16(22)8-18)2-4-14(10)19-9;/h2,4,6-7,12H,3,5,8,18H2,1H3,(H,20,21,23);1H |
| InChIKey | PKNRHFAGUMDGDG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-6-yl] 2-aminoacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-6-yl] 2-aminoacetate;hydrochloride?
The IUPAC name of [3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-6-yl] 2-aminoacetate;hydrochloride (CID 175590062) is [3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-6-yl] 2-aminoacetate;hydrochloride.
What is the SMILES notation for [3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-6-yl] 2-aminoacetate;hydrochloride?
The canonical SMILES for [3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-6-yl] 2-aminoacetate;hydrochloride is Cc1nc2ccc(OC(=O)CN)cc2cc1C1CCC(=O)NC1=O.Cl.
What is the InChIKey of [3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-6-yl] 2-aminoacetate;hydrochloride?
The InChIKey is PKNRHFAGUMDGDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O4.ClH/c1-9-13(12-3-5-15(21)20-17(12)23)7-10-6-11(24-16(22)8-18)2-4-14(10)19-9;/h2,4,6-7,12H,3,5,8,18H2,1H3,(H,20,21,23);1H.
What are the key properties of [3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-6-yl] 2-aminoacetate;hydrochloride?
[3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-6-yl] 2-aminoacetate;hydrochloride has a molecular weight of 363.80 g/mol, XLogP of 1.35, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-6-yl] 2-aminoacetate;hydrochloride is sourced from PubChem (CID 175590062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).