C15H13N3O6 — CID 175130469
[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl] 2-aminoacetate (PubChem CID 175130469) has the molecular formula C15H13N3O6 and a molecular weight of 331.28 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl] 2-aminoacetate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl] 2-aminoacetate |
|---|---|
| PubChem CID | 175130469 |
| Molecular Formula | C15H13N3O6 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl] 2-aminoacetate |
| SMILES | NCC(=O)Oc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C15H13N3O6/c16-6-12(20)24-7-1-2-8-9(5-7)15(23)18(14(8)22)10-3-4-11(19)17-13(10)21/h1-2,5,10H,3-4,6,16H2,(H,17,19,21) |
| InChIKey | VWJPKKVWUGFAQB-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|