C19H23ClN4O7 — CID 163297615
N-[2-(2-aminoethoxy)ethyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyacetamide;hydrochloride (PubChem CID 163297615) has the molecular formula C19H23ClN4O7 and a molecular weight of 454.87 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyacetamide;hydrochloride.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyacetamide;hydrochloride |
|---|---|
| PubChem CID | 163297615 |
| Molecular Formula | C19H23ClN4O7 |
| Molecular Weight | 454.87 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyacetamide;hydrochloride |
| SMILES | Cl.NCCOCCNC(=O)COc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C19H22N4O7.ClH/c20-5-7-29-8-6-21-16(25)10-30-11-1-2-12-13(9-11)19(28)23(18(12)27)14-3-4-15(24)22-17(14)26;/h1-2,9,14H,3-8,10,20H2,(H,21,25)(H,22,24,26);1H |
| InChIKey | FTKQCLLIOQIIOO-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.87 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|