C24H31N5O6 — CID 171554881
N-[4-(4-aminopiperidin-1-yl)butyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyacetamide (PubChem CID 171554881) has the molecular formula C24H31N5O6 and a molecular weight of 485.54 g/mol. Its IUPAC name is N-[4-(4-aminopiperidin-1-yl)butyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyacetamide.
| Compound Name | N-[4-(4-aminopiperidin-1-yl)butyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyacetamide |
|---|---|
| PubChem CID | 171554881 |
| Molecular Formula | C24H31N5O6 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | N-[4-(4-aminopiperidin-1-yl)butyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyacetamide |
| SMILES | NC1CCN(CCCCNC(=O)COc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C24H31N5O6/c25-15-7-11-28(12-8-15)10-2-1-9-26-21(31)14-35-16-3-4-17-18(13-16)24(34)29(23(17)33)19-5-6-20(30)27-22(19)32/h3-4,13,15,19H,1-2,5-12,14,25H2,(H,26,31)(H,27,30,32) |
| InChIKey | CIRJBMZJDBWYFQ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 151.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|