C26H33N5O8 — CID 175196222
[1-[5-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]pentyl]piperidin-4-yl] carbamate (PubChem CID 175196222) has the molecular formula C26H33N5O8 and a molecular weight of 543.58 g/mol. Its IUPAC name is [1-[5-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]pentyl]piperidin-4-yl] carbamate.
| Compound Name | [1-[5-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]pentyl]piperidin-4-yl] carbamate |
|---|---|
| PubChem CID | 175196222 |
| Molecular Formula | C26H33N5O8 |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | [1-[5-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]pentyl]piperidin-4-yl] carbamate |
| SMILES | NC(=O)OC1CCN(CCCCCNC(=O)COc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C26H33N5O8/c27-26(37)39-16-9-13-30(14-10-16)12-3-1-2-11-28-21(33)15-38-19-6-4-5-17-22(19)25(36)31(24(17)35)18-7-8-20(32)29-23(18)34/h4-6,16,18H,1-3,7-15H2,(H2,27,37)(H,28,33)(H,29,32,34) |
| InChIKey | LUANZULDYBGCOR-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 177.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|